C15H24N2O — CID 126750146
2-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]pent-4-enenitrile (PubChem CID 126750146) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]pent-4-enenitrile.
| Compound Name | 2-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]pent-4-enenitrile |
|---|---|
| PubChem CID | 126750146 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-[1-(2,2-dimethylpropanoyl)piperidin-4-yl]pent-4-enenitrile |
| SMILES | C=CCC(C#N)C1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H24N2O/c1-5-6-13(11-16)12-7-9-17(10-8-12)14(18)15(2,3)4/h5,12-13H,1,6-10H2,2-4H3 |
| InChIKey | GDRWCBNHZIRAIE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|