C12H22N2 — CID 126752699
1-tert-butyl-3,5-dimethyl-4-propan-2-ylpyrazole (PubChem CID 126752699) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dimethyl-4-propan-2-ylpyrazole.
| Compound Name | 1-tert-butyl-3,5-dimethyl-4-propan-2-ylpyrazole |
|---|---|
| PubChem CID | 126752699 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-tert-butyl-3,5-dimethyl-4-propan-2-ylpyrazole |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1C(C)C |
| InChI | InChI=1S/C12H22N2/c1-8(2)11-9(3)13-14(10(11)4)12(5,6)7/h8H,1-7H3 |
| InChIKey | VRKJWASMIIVBGX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |