C10H15F3N2 — CID 146379292
1-tert-butyl-3,5-dimethyl-4-(trifluoromethyl)pyrazole (PubChem CID 146379292) has the molecular formula C10H15F3N2 and a molecular weight of 220.24 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dimethyl-4-(trifluoromethyl)pyrazole.
| Compound Name | 1-tert-butyl-3,5-dimethyl-4-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 146379292 |
| Molecular Formula | C10H15F3N2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-tert-butyl-3,5-dimethyl-4-(trifluoromethyl)pyrazole |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2/c1-6-8(10(11,12)13)7(2)15(14-6)9(3,4)5/h1-5H3 |
| InChIKey | VXXJUOZYFSXFQW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |