C10H15F3N2O2 — CID 146379044
1-tert-butyl-3,5-dimethoxy-4-(trifluoromethyl)pyrazole (PubChem CID 146379044) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 1-tert-butyl-3,5-dimethoxy-4-(trifluoromethyl)pyrazole.
| Compound Name | 1-tert-butyl-3,5-dimethoxy-4-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 146379044 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-tert-butyl-3,5-dimethoxy-4-(trifluoromethyl)pyrazole |
| SMILES | COc1nn(C(C)(C)C)c(OC)c1C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O2/c1-9(2,3)15-8(17-5)6(10(11,12)13)7(14-15)16-4/h1-5H3 |
| InChIKey | HIMRGNCGSDIBAF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |