C9H15BrN2O2 — CID 147500583
4-bromo-1-tert-butyl-3,5-dimethoxypyrazole (PubChem CID 147500583) has the molecular formula C9H15BrN2O2 and a molecular weight of 263.13 g/mol. Its IUPAC name is 4-bromo-1-tert-butyl-3,5-dimethoxypyrazole.
| Compound Name | 4-bromo-1-tert-butyl-3,5-dimethoxypyrazole |
|---|---|
| PubChem CID | 147500583 |
| Molecular Formula | C9H15BrN2O2 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 4-bromo-1-tert-butyl-3,5-dimethoxypyrazole |
| SMILES | COc1nn(C(C)(C)C)c(OC)c1Br |
| InChI | InChI=1S/C9H15BrN2O2/c1-9(2,3)12-8(14-5)6(10)7(11-12)13-4/h1-5H3 |
| InChIKey | FHIHJKZBDNCCKD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |