C10H12F6N2 — CID 146379193
1-tert-butyl-4-methyl-3,5-bis(trifluoromethyl)pyrazole (PubChem CID 146379193) has the molecular formula C10H12F6N2 and a molecular weight of 274.21 g/mol. Its IUPAC name is 1-tert-butyl-4-methyl-3,5-bis(trifluoromethyl)pyrazole.
| Compound Name | 1-tert-butyl-4-methyl-3,5-bis(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 146379193 |
| Molecular Formula | C10H12F6N2 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-tert-butyl-4-methyl-3,5-bis(trifluoromethyl)pyrazole |
| SMILES | Cc1c(C(F)(F)F)nn(C(C)(C)C)c1C(F)(F)F |
| InChI | InChI=1S/C10H12F6N2/c1-5-6(9(11,12)13)17-18(8(2,3)4)7(5)10(14,15)16/h1-4H3 |
| InChIKey | DKUKSCMUMDRZFT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |