C25H28N5O2S+ — CID 126753187
1-[5-(3-cyclobutyl-1-methylsulfonyl-1-phenylpyrazol-1-ium-4-yl)-2-pyridinyl]piperidine-4-carbonitrile (PubChem CID 126753187) has the molecular formula C25H28N5O2S+ and a molecular weight of 462.60 g/mol. Its IUPAC name is 1-[5-(3-cyclobutyl-1-methylsulfonyl-1-phenylpyrazol-1-ium-4-yl)-2-pyridinyl]piperidine-4-carbonitrile.
| Compound Name | 1-[5-(3-cyclobutyl-1-methylsulfonyl-1-phenylpyrazol-1-ium-4-yl)-2-pyridinyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 126753187 |
| Molecular Formula | C25H28N5O2S+ |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 1-[5-(3-cyclobutyl-1-methylsulfonyl-1-phenylpyrazol-1-ium-4-yl)-2-pyridinyl]piperidine-4-carbonitrile |
| SMILES | CS(=O)(=O)[N+]1(c2ccccc2)C=C(c2ccc(N3CCC(C#N)CC3)nc2)C(C2CCC2)=N1 |
| InChI | InChI=1S/C25H28N5O2S/c1-33(31,32)30(22-8-3-2-4-9-22)18-23(25(28-30)20-6-5-7-20)21-10-11-24(27-17-21)29-14-12-19(16-26)13-15-29/h2-4,8-11,17-20H,5-7,12-15H2,1H3/q+1 |
| InChIKey | TYNHVLIVOIYRCM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|