C30H35N8O2S+ — CID 145290623
[4-[6-(4-cyanopiperidin-1-yl)-3-pyridinyl]-6-(methylsulfanylcarbamoyl)-3-(C-piperidin-4-yloxycarbonimidoyl)-2-pyridinyl]-phenylazanium (PubChem CID 145290623) has the molecular formula C30H35N8O2S+ and a molecular weight of 571.73 g/mol. Its IUPAC name is [4-[6-(4-cyanopiperidin-1-yl)-3-pyridinyl]-6-(methylsulfanylcarbamoyl)-3-(C-piperidin-4-yloxycarbonimidoyl)-2-pyridinyl]-phenylazanium.
| Compound Name | [4-[6-(4-cyanopiperidin-1-yl)-3-pyridinyl]-6-(methylsulfanylcarbamoyl)-3-(C-piperidin-4-yloxycarbonimidoyl)-2-pyridinyl]-phenylazanium |
|---|---|
| PubChem CID | 145290623 |
| Molecular Formula | C30H35N8O2S+ |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | [4-[6-(4-cyanopiperidin-1-yl)-3-pyridinyl]-6-(methylsulfanylcarbamoyl)-3-(C-piperidin-4-yloxycarbonimidoyl)-2-pyridinyl]-phenylazanium |
| SMILES | [H]/N=C(\OC1CCNCC1)c1c(-c2ccc(N3CCC(C#N)CC3)nc2)cc(C(=O)NSC)nc1[NH2+]c1ccccc1 |
| InChI | InChI=1S/C30H34N8O2S/c1-41-37-30(39)25-17-24(21-7-8-26(34-19-21)38-15-11-20(18-31)12-16-38)27(28(32)40-23-9-13-33-14-10-23)29(36-25)35-22-5-3-2-4-6-22/h2-8,17,19-20,23,32-33H,9-16H2,1H3,(H,35,36)(H,37,39)/p+1/b32-28- |
| InChIKey | YWVCEYRRLMSENP-BLCKFSMSSA-O |
| XLogP | 3.51 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|