C16H16N2O5S2 — CID 126756514
4-methyl-N-[4-[(2-oxooxolan-3-yl)sulfamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 126756514) has the molecular formula C16H16N2O5S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-methyl-N-[4-[(2-oxooxolan-3-yl)sulfamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | 4-methyl-N-[4-[(2-oxooxolan-3-yl)sulfamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126756514 |
| Molecular Formula | C16H16N2O5S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 4-methyl-N-[4-[(2-oxooxolan-3-yl)sulfamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2ccc(S(=O)(=O)NC3CCOC3=O)cc2)c1 |
| InChI | InChI=1S/C16H16N2O5S2/c1-10-8-14(24-9-10)15(19)17-11-2-4-12(5-3-11)25(21,22)18-13-6-7-23-16(13)20/h2-5,8-9,13,18H,6-7H2,1H3,(H,17,19) |
| InChIKey | ZHEQZRIHGBEQQV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |