C15H13BrN2O6S — CID 126756539
5-bromo-N-[4-[(2-oxooxolan-3-yl)sulfamoyl]phenyl]furan-2-carboxamide (PubChem CID 126756539) has the molecular formula C15H13BrN2O6S and a molecular weight of 429.25 g/mol. Its IUPAC name is 5-bromo-N-[4-[(2-oxooxolan-3-yl)sulfamoyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[(2-oxooxolan-3-yl)sulfamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126756539 |
| Molecular Formula | C15H13BrN2O6S |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 5-bromo-N-[4-[(2-oxooxolan-3-yl)sulfamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC2CCOC2=O)cc1)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H13BrN2O6S/c16-13-6-5-12(24-13)14(19)17-9-1-3-10(4-2-9)25(21,22)18-11-7-8-23-15(11)20/h1-6,11,18H,7-8H2,(H,17,19) |
| InChIKey | KLXNFKPDCMUJEG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |