C17H15FN2O5S — CID 78318477
2-fluoro-N-[4-[[(3S)-2-oxooxolan-3-yl]sulfamoyl]phenyl]benzamide (PubChem CID 78318477) has the molecular formula C17H15FN2O5S and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-fluoro-N-[4-[[(3S)-2-oxooxolan-3-yl]sulfamoyl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[[(3S)-2-oxooxolan-3-yl]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 78318477 |
| Molecular Formula | C17H15FN2O5S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-fluoro-N-[4-[[(3S)-2-oxooxolan-3-yl]sulfamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N[C@H]2CCOC2=O)cc1)c1ccccc1F |
| InChI | InChI=1S/C17H15FN2O5S/c18-14-4-2-1-3-13(14)16(21)19-11-5-7-12(8-6-11)26(23,24)20-15-9-10-25-17(15)22/h1-8,15,20H,9-10H2,(H,19,21)/t15-/m0/s1 |
| InChIKey | WQOXQZXBOGWIJR-HNNXBMFYSA-N |
| XLogP | 1.67 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |