C13H13BrFN3S — CID 126757166
N-[1-(2-bromo-4-fluorophenyl)ethyl]-N'-methyl-1,3-thiazole-2-carboximidamide (PubChem CID 126757166) has the molecular formula C13H13BrFN3S and a molecular weight of 342.24 g/mol. Its IUPAC name is N-[1-(2-bromo-4-fluorophenyl)ethyl]-N'-methyl-1,3-thiazole-2-carboximidamide.
| Compound Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-N'-methyl-1,3-thiazole-2-carboximidamide |
|---|---|
| PubChem CID | 126757166 |
| Molecular Formula | C13H13BrFN3S |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-N'-methyl-1,3-thiazole-2-carboximidamide |
| SMILES | C/N=C(/NC(C)c1ccc(F)cc1Br)c1nccs1 |
| InChI | InChI=1S/C13H13BrFN3S/c1-8(10-4-3-9(15)7-11(10)14)18-12(16-2)13-17-5-6-19-13/h3-8H,1-2H3,(H,16,18) |
| InChIKey | LCWVOBDIZGQKAH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|