C15H12F6N4O4 — CID 1267584
2-morpholin-4-yl-6-(3-nitrophenyl)-4,4-bis(trifluoromethyl)-1,3,5-oxadiazine (PubChem CID 1267584) has the molecular formula C15H12F6N4O4 and a molecular weight of 426.27 g/mol. Its IUPAC name is 2-morpholin-4-yl-6-(3-nitrophenyl)-4,4-bis(trifluoromethyl)-1,3,5-oxadiazine.
| Compound Name | 2-morpholin-4-yl-6-(3-nitrophenyl)-4,4-bis(trifluoromethyl)-1,3,5-oxadiazine |
|---|---|
| PubChem CID | 1267584 |
| Molecular Formula | C15H12F6N4O4 |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2-morpholin-4-yl-6-(3-nitrophenyl)-4,4-bis(trifluoromethyl)-1,3,5-oxadiazine |
| SMILES | O=[N+]([O-])c1cccc(C2=NC(C(F)(F)F)(C(F)(F)F)N=C(N3CCOCC3)O2)c1 |
| InChI | InChI=1S/C15H12F6N4O4/c16-14(17,18)13(15(19,20)21)22-11(9-2-1-3-10(8-9)25(26)27)29-12(23-13)24-4-6-28-7-5-24/h1-3,8H,4-7H2 |
| InChIKey | NGOKCUKVRROIHH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|