C25H34O6 — CID 126760702
1-O-[[6-[(E)-but-2-enoyl]oxy-6-methyl-2-bicyclo[2.2.1]heptanyl]methyl] 4-O-(2-methyl-2-bicyclo[2.2.1]heptanyl) (Z)-but-2-enedioate (PubChem CID 126760702) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 1-O-[[6-[(E)-but-2-enoyl]oxy-6-methyl-2-bicyclo[2.2.1]heptanyl]methyl] 4-O-(2-methyl-2-bicyclo[2.2.1]heptanyl) (Z)-but-2-enedioate.
| Compound Name | 1-O-[[6-[(E)-but-2-enoyl]oxy-6-methyl-2-bicyclo[2.2.1]heptanyl]methyl] 4-O-(2-methyl-2-bicyclo[2.2.1]heptanyl) (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 126760702 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1-O-[[6-[(E)-but-2-enoyl]oxy-6-methyl-2-bicyclo[2.2.1]heptanyl]methyl] 4-O-(2-methyl-2-bicyclo[2.2.1]heptanyl) (Z)-but-2-enedioate |
| SMILES | C/C=C/C(=O)OC1(C)CC2CC(COC(=O)/C=C\C(=O)OC3(C)CC4CCC3C4)C1C2 |
| InChI | InChI=1S/C25H34O6/c1-4-5-22(27)31-25(3)14-17-10-18(20(25)12-17)15-29-21(26)8-9-23(28)30-24(2)13-16-6-7-19(24)11-16/h4-5,8-9,16-20H,6-7,10-15H2,1-3H3/b5-4+,9-8- |
| InChIKey | IGNMRQAZGOMMKS-PXJZJIAOSA-N |
| XLogP | 4.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|