C10H16O3 — CID 134309639
methyl (2-methyl-2-bicyclo[2.2.1]heptanyl) carbonate (PubChem CID 134309639) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is methyl (2-methyl-2-bicyclo[2.2.1]heptanyl) carbonate.
| Compound Name | methyl (2-methyl-2-bicyclo[2.2.1]heptanyl) carbonate |
|---|---|
| PubChem CID | 134309639 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | methyl (2-methyl-2-bicyclo[2.2.1]heptanyl) carbonate |
| SMILES | COC(=O)OC1(C)CC2CCC1C2 |
| InChI | InChI=1S/C10H16O3/c1-10(13-9(11)12-2)6-7-3-4-8(10)5-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | KZFGZUOHEUNYJB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |