C16H24O2 — CID 134285849
[(2R)-2-methyl-2-bicyclo[2.2.1]heptanyl] bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 134285849) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is [(2R)-2-methyl-2-bicyclo[2.2.1]heptanyl] bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [(2R)-2-methyl-2-bicyclo[2.2.1]heptanyl] bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 134285849 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | [(2R)-2-methyl-2-bicyclo[2.2.1]heptanyl] bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C[C@@]1(OC(=O)C2CC3CCC2C3)CC2CCC1C2 |
| InChI | InChI=1S/C16H24O2/c1-16(9-11-3-5-13(16)7-11)18-15(17)14-8-10-2-4-12(14)6-10/h10-14H,2-9H2,1H3/t10?,11?,12?,13?,14?,16-/m1/s1 |
| InChIKey | NVJDGOUJHQEQOQ-ALBOGACASA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |