C20H28F4N2 — CID 126762379
N-[1-[4-(2-ethylbutyl)piperidin-1-yl]ethenyl]-3-fluoro-5-(trifluoromethyl)aniline (PubChem CID 126762379) has the molecular formula C20H28F4N2 and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[1-[4-(2-ethylbutyl)piperidin-1-yl]ethenyl]-3-fluoro-5-(trifluoromethyl)aniline.
| Compound Name | N-[1-[4-(2-ethylbutyl)piperidin-1-yl]ethenyl]-3-fluoro-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 126762379 |
| Molecular Formula | C20H28F4N2 |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[1-[4-(2-ethylbutyl)piperidin-1-yl]ethenyl]-3-fluoro-5-(trifluoromethyl)aniline |
| SMILES | C=C(Nc1cc(F)cc(C(F)(F)F)c1)N1CCC(CC(CC)CC)CC1 |
| InChI | InChI=1S/C20H28F4N2/c1-4-15(5-2)10-16-6-8-26(9-7-16)14(3)25-19-12-17(20(22,23)24)11-18(21)13-19/h11-13,15-16,25H,3-10H2,1-2H3 |
| InChIKey | MRDYREWLNXVIKU-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |