C16H13FO4 — CID 126763491
methyl 5-(3-fluoro-5-formyl-4-hydroxyphenyl)cyclohepta-1,4,6-triene-1-carboxylate (PubChem CID 126763491) has the molecular formula C16H13FO4 and a molecular weight of 288.27 g/mol. Its IUPAC name is methyl 5-(3-fluoro-5-formyl-4-hydroxyphenyl)cyclohepta-1,4,6-triene-1-carboxylate.
| Compound Name | methyl 5-(3-fluoro-5-formyl-4-hydroxyphenyl)cyclohepta-1,4,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 126763491 |
| Molecular Formula | C16H13FO4 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | methyl 5-(3-fluoro-5-formyl-4-hydroxyphenyl)cyclohepta-1,4,6-triene-1-carboxylate |
| SMILES | COC(=O)C1=CCC=C(c2cc(F)c(O)c(C=O)c2)C=C1 |
| InChI | InChI=1S/C16H13FO4/c1-21-16(20)11-4-2-3-10(5-6-11)12-7-13(9-18)15(19)14(17)8-12/h3-9,19H,2H2,1H3 |
| InChIKey | YHUFKHGBFBRDRT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|