C18H27N7 — CID 12676683
2,3-bis(4-methylpiperazin-1-yl)quinoxalin-5-amine (PubChem CID 12676683) has the molecular formula C18H27N7 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2,3-bis(4-methylpiperazin-1-yl)quinoxalin-5-amine.
| Compound Name | 2,3-bis(4-methylpiperazin-1-yl)quinoxalin-5-amine |
|---|---|
| PubChem CID | 12676683 |
| Molecular Formula | C18H27N7 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 2,3-bis(4-methylpiperazin-1-yl)quinoxalin-5-amine |
| SMILES | CN1CCN(c2nc3cccc(N)c3nc2N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C18H27N7/c1-22-6-10-24(11-7-22)17-18(25-12-8-23(2)9-13-25)21-16-14(19)4-3-5-15(16)20-17/h3-5H,6-13,19H2,1-2H3 |
| InChIKey | BAXLAJOXQYMMQH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 64.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|