C19H17ClN4O3 — CID 126767001
4-[1-(4-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carbonyl]-3-methylpiperazin-2-one (PubChem CID 126767001) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carbonyl]-3-methylpiperazin-2-one.
| Compound Name | 4-[1-(4-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carbonyl]-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 126767001 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 4-[1-(4-chlorophenyl)-5-(furan-2-yl)pyrazole-3-carbonyl]-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1C(=O)c1cc(-c2ccco2)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H17ClN4O3/c1-12-18(25)21-8-9-23(12)19(26)15-11-16(17-3-2-10-27-17)24(22-15)14-6-4-13(20)5-7-14/h2-7,10-12H,8-9H2,1H3,(H,21,25) |
| InChIKey | LBJJHHOCMRURRF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |