C17H21F2N3O3 — CID 126769632
N-cyclopropyl-1-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]pyrrolidine-2-carboxamide (PubChem CID 126769632) has the molecular formula C17H21F2N3O3 and a molecular weight of 353.37 g/mol. Its IUPAC name is N-cyclopropyl-1-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]pyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropyl-1-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126769632 |
| Molecular Formula | C17H21F2N3O3 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-cyclopropyl-1-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(CN1CCCC1C(=O)NC1CC1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H21F2N3O3/c18-17(19)25-13-7-5-11(6-8-13)20-15(23)10-22-9-1-2-14(22)16(24)21-12-3-4-12/h5-8,12,14,17H,1-4,9-10H2,(H,20,23)(H,21,24) |
| InChIKey | HUJWVERMFRXSOB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |