C16H26N4O3 — CID 42884475
1-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]-N-cyclopropylpyrrolidine-2-carboxamide (PubChem CID 42884475) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]-N-cyclopropylpyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]-N-cyclopropylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42884475 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-[2-(cyclopentylcarbamoylamino)-2-oxoethyl]-N-cyclopropylpyrrolidine-2-carboxamide |
| SMILES | O=C(CN1CCCC1C(=O)NC1CC1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H26N4O3/c21-14(19-16(23)18-11-4-1-2-5-11)10-20-9-3-6-13(20)15(22)17-12-7-8-12/h11-13H,1-10H2,(H,17,22)(H2,18,19,21,23) |
| InChIKey | UVVMIXXOZRKNSB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |