C21H30N4O3 — CID 86924989
N-cyclopropyl-1-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]pyrrolidine-2-carboxamide (PubChem CID 86924989) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-cyclopropyl-1-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]pyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropyl-1-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 86924989 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-cyclopropyl-1-[2-[3-(diethylcarbamoyl)anilino]-2-oxoethyl]pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(NC(=O)CN2CCCC2C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C21H30N4O3/c1-3-24(4-2)21(28)15-7-5-8-17(13-15)22-19(26)14-25-12-6-9-18(25)20(27)23-16-10-11-16/h5,7-8,13,16,18H,3-4,6,9-12,14H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | BTXCWOREQBPGRS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |