C18H24ClNO4 — CID 126770036
1-[3-(2-butan-2-yloxyphenyl)prop-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 126770036) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is 1-[3-(2-butan-2-yloxyphenyl)prop-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[3-(2-butan-2-yloxyphenyl)prop-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 126770036 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[3-(2-butan-2-yloxyphenyl)prop-2-enoyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | CCC(C)Oc1ccccc1C=CC(=O)N1CCC(C(=O)O)C1.Cl |
| InChI | InChI=1S/C18H23NO4.ClH/c1-3-13(2)23-16-7-5-4-6-14(16)8-9-17(20)19-11-10-15(12-19)18(21)22;/h4-9,13,15H,3,10-12H2,1-2H3,(H,21,22);1H |
| InChIKey | NCHFGNQDGGTFPV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|