C16H21NO4S — CID 95763769
(E)-3-[2-[(2R)-butan-2-yl]oxyphenyl]-1-(1,1-dioxo-1,2-thiazolidin-2-yl)prop-2-en-1-one (PubChem CID 95763769) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (E)-3-[2-[(2R)-butan-2-yl]oxyphenyl]-1-(1,1-dioxo-1,2-thiazolidin-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-[(2R)-butan-2-yl]oxyphenyl]-1-(1,1-dioxo-1,2-thiazolidin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 95763769 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (E)-3-[2-[(2R)-butan-2-yl]oxyphenyl]-1-(1,1-dioxo-1,2-thiazolidin-2-yl)prop-2-en-1-one |
| SMILES | CC[C@@H](C)Oc1ccccc1/C=C/C(=O)N1CCCS1(=O)=O |
| InChI | InChI=1S/C16H21NO4S/c1-3-13(2)21-15-8-5-4-7-14(15)9-10-16(18)17-11-6-12-22(17,19)20/h4-5,7-10,13H,3,6,11-12H2,1-2H3/b10-9+/t13-/m1/s1 |
| InChIKey | XQOVEVFJSOCNJG-WTNCMQEWSA-N |
| XLogP | 2.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|