C19H28N4OS — CID 126776149
N,N-dimethyl-1-[[methyl-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]amino]methyl]cyclobutan-1-amine (PubChem CID 126776149) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is N,N-dimethyl-1-[[methyl-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]amino]methyl]cyclobutan-1-amine.
| Compound Name | N,N-dimethyl-1-[[methyl-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]amino]methyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 126776149 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N,N-dimethyl-1-[[methyl-[[5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl]amino]methyl]cyclobutan-1-amine |
| SMILES | CN(Cc1nnc(-c2cc3c(s2)CCCC3)o1)CC1(N(C)C)CCC1 |
| InChI | InChI=1S/C19H28N4OS/c1-22(2)19(9-6-10-19)13-23(3)12-17-20-21-18(24-17)16-11-14-7-4-5-8-15(14)25-16/h11H,4-10,12-13H2,1-3H3 |
| InChIKey | LSGGJGJCUQNTQJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |