C15H16F2N4O3 — CID 126779104
1-[2-[2-(difluoromethoxy)phenyl]ethyl]-3-(4-methoxypyrimidin-5-yl)urea (PubChem CID 126779104) has the molecular formula C15H16F2N4O3 and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-[2-[2-(difluoromethoxy)phenyl]ethyl]-3-(4-methoxypyrimidin-5-yl)urea.
| Compound Name | 1-[2-[2-(difluoromethoxy)phenyl]ethyl]-3-(4-methoxypyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 126779104 |
| Molecular Formula | C15H16F2N4O3 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[2-[2-(difluoromethoxy)phenyl]ethyl]-3-(4-methoxypyrimidin-5-yl)urea |
| SMILES | COc1ncncc1NC(=O)NCCc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H16F2N4O3/c1-23-13-11(8-18-9-20-13)21-15(22)19-7-6-10-4-2-3-5-12(10)24-14(16)17/h2-5,8-9,14H,6-7H2,1H3,(H2,19,21,22) |
| InChIKey | UBLNRECLVRFQRU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |