C18H20Cl2N4O2 — CID 126785065
(2R)-N-[4-(benzimidazol-1-yl)phenyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 126785065) has the molecular formula C18H20Cl2N4O2 and a molecular weight of 395.29 g/mol. Its IUPAC name is (2R)-N-[4-(benzimidazol-1-yl)phenyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | (2R)-N-[4-(benzimidazol-1-yl)phenyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 126785065 |
| Molecular Formula | C18H20Cl2N4O2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | (2R)-N-[4-(benzimidazol-1-yl)phenyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc(-n2cnc3ccccc32)cc1)[C@H]1CNCCO1 |
| InChI | InChI=1S/C18H18N4O2.2ClH/c23-18(17-11-19-9-10-24-17)21-13-5-7-14(8-6-13)22-12-20-15-3-1-2-4-16(15)22;;/h1-8,12,17,19H,9-11H2,(H,21,23);2*1H/t17-;;/m1../s1 |
| InChIKey | DLWNMBOQXUITNA-ZEECNFPPSA-N |
| XLogP | 2.80 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |