C23H19N3O2 — CID 24512634
N-[4-(benzimidazol-1-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 24512634) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-[4-(benzimidazol-1-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-[4-(benzimidazol-1-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 24512634 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[4-(benzimidazol-1-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cnc3ccccc32)cc1)C1COc2ccccc2C1 |
| InChI | InChI=1S/C23H19N3O2/c27-23(17-13-16-5-1-4-8-22(16)28-14-17)25-18-9-11-19(12-10-18)26-15-24-20-6-2-3-7-21(20)26/h1-12,15,17H,13-14H2,(H,25,27) |
| InChIKey | PWMGHVAVWKZKGQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |