C25H22N4O3 — CID 55556169
N-[4-(benzimidazol-1-yl)phenyl]-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55556169) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-[4-(benzimidazol-1-yl)phenyl]-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[4-(benzimidazol-1-yl)phenyl]-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55556169 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[4-(benzimidazol-1-yl)phenyl]-1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cccc(N2CC(C(=O)Nc3ccc(-n4cnc5ccccc54)cc3)CC2=O)c1 |
| InChI | InChI=1S/C25H22N4O3/c1-32-21-6-4-5-20(14-21)28-15-17(13-24(28)30)25(31)27-18-9-11-19(12-10-18)29-16-26-22-7-2-3-8-23(22)29/h2-12,14,16-17H,13,15H2,1H3,(H,27,31) |
| InChIKey | LMANNEVZWAHQLQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |