C24H19FN4O2 — CID 42883707
N-[4-(benzimidazol-1-yl)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 42883707) has the molecular formula C24H19FN4O2 and a molecular weight of 414.44 g/mol. Its IUPAC name is N-[4-(benzimidazol-1-yl)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[4-(benzimidazol-1-yl)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42883707 |
| Molecular Formula | C24H19FN4O2 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[4-(benzimidazol-1-yl)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cnc3ccccc32)cc1)C1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C24H19FN4O2/c25-19-5-1-3-7-21(19)28-14-16(13-23(28)30)24(31)27-17-9-11-18(12-10-17)29-15-26-20-6-2-4-8-22(20)29/h1-12,15-16H,13-14H2,(H,27,31) |
| InChIKey | KCTGWDJGAPDPDB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |