C17H13F4N3O2 — CID 166318281
1-(2-fluorophenyl)-5-oxo-N-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide (PubChem CID 166318281) has the molecular formula C17H13F4N3O2 and a molecular weight of 367.30 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-5-oxo-N-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-5-oxo-N-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 166318281 |
| Molecular Formula | C17H13F4N3O2 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 1-(2-fluorophenyl)-5-oxo-N-[5-(trifluoromethyl)-3-pyridinyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cncc(C(F)(F)F)c1)C1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C17H13F4N3O2/c18-13-3-1-2-4-14(13)24-9-10(5-15(24)25)16(26)23-12-6-11(7-22-8-12)17(19,20)21/h1-4,6-8,10H,5,9H2,(H,23,26) |
| InChIKey | YONJLNZJJLIGOC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |