C17H12F4N2O2 — CID 51176548
1-(2-fluorophenyl)-5-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 51176548) has the molecular formula C17H12F4N2O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-5-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-5-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51176548 |
| Molecular Formula | C17H12F4N2O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1-(2-fluorophenyl)-5-oxo-N-(2,3,4-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C17H12F4N2O2/c18-10-3-1-2-4-13(10)23-8-9(7-14(23)24)17(25)22-12-6-5-11(19)15(20)16(12)21/h1-6,9H,7-8H2,(H,22,25) |
| InChIKey | RWNAOQYHDXSZHZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|