C19H19ClFN3O2 — CID 55358717
N-[5-chloro-2-(dimethylamino)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55358717) has the molecular formula C19H19ClFN3O2 and a molecular weight of 375.83 g/mol. Its IUPAC name is N-[5-chloro-2-(dimethylamino)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[5-chloro-2-(dimethylamino)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55358717 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-[5-chloro-2-(dimethylamino)phenyl]-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(C)c1ccc(Cl)cc1NC(=O)C1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C19H19ClFN3O2/c1-23(2)17-8-7-13(20)10-15(17)22-19(26)12-9-18(25)24(11-12)16-6-4-3-5-14(16)21/h3-8,10,12H,9,11H2,1-2H3,(H,22,26) |
| InChIKey | FNQXWINVJNQQBP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |