C19H20N2O4S — CID 126793094
5-[(5-methoxy-2,3-dihydroindol-1-yl)sulfonyl]-3,3-dimethyl-1H-indol-2-one (PubChem CID 126793094) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 5-[(5-methoxy-2,3-dihydroindol-1-yl)sulfonyl]-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-[(5-methoxy-2,3-dihydroindol-1-yl)sulfonyl]-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 126793094 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 5-[(5-methoxy-2,3-dihydroindol-1-yl)sulfonyl]-3,3-dimethyl-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)CCN2S(=O)(=O)c1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C19H20N2O4S/c1-19(2)15-11-14(5-6-16(15)20-18(19)22)26(23,24)21-9-8-12-10-13(25-3)4-7-17(12)21/h4-7,10-11H,8-9H2,1-3H3,(H,20,22) |
| InChIKey | IMUXCJXQOFAWPW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |