C17H24N2O3S — CID 56730285
5-(3,5-dimethylpiperidin-1-yl)sulfonyl-3,3-dimethyl-1H-indol-2-one (PubChem CID 56730285) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 56730285 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc3c(c2)C(C)(C)C(=O)N3)C1 |
| InChI | InChI=1S/C17H24N2O3S/c1-11-7-12(2)10-19(9-11)23(21,22)13-5-6-15-14(8-13)17(3,4)16(20)18-15/h5-6,8,11-12H,7,9-10H2,1-4H3,(H,18,20) |
| InChIKey | CJHQTGKWRACOLD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |