C19H17NO5S — CID 30713933
6-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]chromen-2-one (PubChem CID 30713933) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is 6-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]chromen-2-one.
| Compound Name | 6-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]chromen-2-one |
|---|---|
| PubChem CID | 30713933 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 6-[(6-methoxy-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]chromen-2-one |
| SMILES | COc1ccc2c(c1)CCCN2S(=O)(=O)c1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C19H17NO5S/c1-24-15-5-7-17-13(11-15)3-2-10-20(17)26(22,23)16-6-8-18-14(12-16)4-9-19(21)25-18/h4-9,11-12H,2-3,10H2,1H3 |
| InChIKey | MJDPZORRSZICRZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|