C19H21ClN2O2 — CID 126793549
1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[2-(2-methoxyethyl)phenyl]urea (PubChem CID 126793549) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[2-(2-methoxyethyl)phenyl]urea.
| Compound Name | 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[2-(2-methoxyethyl)phenyl]urea |
|---|---|
| PubChem CID | 126793549 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(5-chloro-2,3-dihydro-1H-inden-1-yl)-3-[2-(2-methoxyethyl)phenyl]urea |
| SMILES | COCCc1ccccc1NC(=O)NC1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H21ClN2O2/c1-24-11-10-13-4-2-3-5-17(13)21-19(23)22-18-9-6-14-12-15(20)7-8-16(14)18/h2-5,7-8,12,18H,6,9-11H2,1H3,(H2,21,22,23) |
| InChIKey | HZUKDIMCIMPYDT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |