C27H29N3O3 — CID 143240748
1-[5-[4-(2-aminophenyl)butanoyl]-2,3-dihydro-1H-inden-1-yl]-3-(2-methoxyphenyl)urea (PubChem CID 143240748) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[5-[4-(2-aminophenyl)butanoyl]-2,3-dihydro-1H-inden-1-yl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[5-[4-(2-aminophenyl)butanoyl]-2,3-dihydro-1H-inden-1-yl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 143240748 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-[5-[4-(2-aminophenyl)butanoyl]-2,3-dihydro-1H-inden-1-yl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NC1CCc2cc(C(=O)CCCc3ccccc3N)ccc21 |
| InChI | InChI=1S/C27H29N3O3/c1-33-26-12-5-4-10-24(26)30-27(32)29-23-16-14-19-17-20(13-15-21(19)23)25(31)11-6-8-18-7-2-3-9-22(18)28/h2-5,7,9-10,12-13,15,17,23H,6,8,11,14,16,28H2,1H3,(H2,29,30,32) |
| InChIKey | WZEHYNNWSNELIL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|