C16H24N4O — CID 126796537
3-[3-(2-hydroxycyclohexyl)propylamino]-5,6-dimethylpyridazine-4-carbonitrile (PubChem CID 126796537) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-[3-(2-hydroxycyclohexyl)propylamino]-5,6-dimethylpyridazine-4-carbonitrile.
| Compound Name | 3-[3-(2-hydroxycyclohexyl)propylamino]-5,6-dimethylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 126796537 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 3-[3-(2-hydroxycyclohexyl)propylamino]-5,6-dimethylpyridazine-4-carbonitrile |
| SMILES | Cc1nnc(NCCCC2CCCCC2O)c(C#N)c1C |
| InChI | InChI=1S/C16H24N4O/c1-11-12(2)19-20-16(14(11)10-17)18-9-5-7-13-6-3-4-8-15(13)21/h13,15,21H,3-9H2,1-2H3,(H,18,20) |
| InChIKey | ZKQVWEJLJVTDIE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|