C12H15N7 — CID 78998795
5,6-dimethyl-3-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridazine-4-carbonitrile (PubChem CID 78998795) has the molecular formula C12H15N7 and a molecular weight of 257.30 g/mol. Its IUPAC name is 5,6-dimethyl-3-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridazine-4-carbonitrile.
| Compound Name | 5,6-dimethyl-3-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 78998795 |
| Molecular Formula | C12H15N7 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 5,6-dimethyl-3-[3-(1H-1,2,4-triazol-5-yl)propylamino]pyridazine-4-carbonitrile |
| SMILES | Cc1nnc(NCCCc2ncn[nH]2)c(C#N)c1C |
| InChI | InChI=1S/C12H15N7/c1-8-9(2)17-19-12(10(8)6-13)14-5-3-4-11-15-7-16-18-11/h7H,3-5H2,1-2H3,(H,14,19)(H,15,16,18) |
| InChIKey | NGXWKANFADVLPM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|