C15H22F2N2O4 — CID 126796657
3-(4,5-difluoro-2-methoxyphenyl)-1-[2-(2-hydroxyethoxy)ethyl]-1-propan-2-ylurea (PubChem CID 126796657) has the molecular formula C15H22F2N2O4 and a molecular weight of 332.35 g/mol. Its IUPAC name is 3-(4,5-difluoro-2-methoxyphenyl)-1-[2-(2-hydroxyethoxy)ethyl]-1-propan-2-ylurea.
| Compound Name | 3-(4,5-difluoro-2-methoxyphenyl)-1-[2-(2-hydroxyethoxy)ethyl]-1-propan-2-ylurea |
|---|---|
| PubChem CID | 126796657 |
| Molecular Formula | C15H22F2N2O4 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-(4,5-difluoro-2-methoxyphenyl)-1-[2-(2-hydroxyethoxy)ethyl]-1-propan-2-ylurea |
| SMILES | COc1cc(F)c(F)cc1NC(=O)N(CCOCCO)C(C)C |
| InChI | InChI=1S/C15H22F2N2O4/c1-10(2)19(4-6-23-7-5-20)15(21)18-13-8-11(16)12(17)9-14(13)22-3/h8-10,20H,4-7H2,1-3H3,(H,18,21) |
| InChIKey | MWOZZUNMGDSGFK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|