About (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol
(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol (PubChem CID 12679842) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol.
Analyze (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol?
The IUPAC name of (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol (CID 12679842) is (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol.
What is the SMILES notation for (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol?
The canonical SMILES for (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol is COC1=CCC(C)(CO)C=C1.
What is the InChIKey of (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol?
The InChIKey is FJPCMXRAVKRUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-9(7-10)5-3-8(11-2)4-6-9/h3-5,10H,6-7H2,1-2H3.
What are the key properties of (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol?
(4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol has a molecular weight of 154.21 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-1-methylcyclohexa-2,4-dien-1-yl)methanol is sourced from PubChem (CID 12679842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).