C12H12F3N5O — CID 126799440
N-methyl-N-[1-(2H-tetrazol-5-yl)ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 126799440) has the molecular formula C12H12F3N5O and a molecular weight of 299.26 g/mol. Its IUPAC name is N-methyl-N-[1-(2H-tetrazol-5-yl)ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-methyl-N-[1-(2H-tetrazol-5-yl)ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 126799440 |
| Molecular Formula | C12H12F3N5O |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-methyl-N-[1-(2H-tetrazol-5-yl)ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(c1nn[nH]n1)N(C)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F3N5O/c1-7(10-16-18-19-17-10)20(2)11(21)8-3-5-9(6-4-8)12(13,14)15/h3-7H,1-2H3,(H,16,17,18,19) |
| InChIKey | ITGCFKJEGBNZNX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |