C14H14F3N5O2 — CID 126798262
[4-hydroxy-4-(2H-tetrazol-5-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 126798262) has the molecular formula C14H14F3N5O2 and a molecular weight of 341.29 g/mol. Its IUPAC name is [4-hydroxy-4-(2H-tetrazol-5-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-hydroxy-4-(2H-tetrazol-5-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 126798262 |
| Molecular Formula | C14H14F3N5O2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [4-hydroxy-4-(2H-tetrazol-5-yl)piperidin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCC(O)(c2nn[nH]n2)CC1 |
| InChI | InChI=1S/C14H14F3N5O2/c15-14(16,17)10-3-1-9(2-4-10)11(23)22-7-5-13(24,6-8-22)12-18-20-21-19-12/h1-4,24H,5-8H2,(H,18,19,20,21) |
| InChIKey | GQTVYLIUROLKTP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |