C19H28N2O3S — CID 126801738
1-benzyl-N-[[2-(methanesulfonamido)cyclohexyl]methyl]cyclopropane-1-carboxamide (PubChem CID 126801738) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is 1-benzyl-N-[[2-(methanesulfonamido)cyclohexyl]methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-benzyl-N-[[2-(methanesulfonamido)cyclohexyl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 126801738 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-benzyl-N-[[2-(methanesulfonamido)cyclohexyl]methyl]cyclopropane-1-carboxamide |
| SMILES | CS(=O)(=O)NC1CCCCC1CNC(=O)C1(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N2O3S/c1-25(23,24)21-17-10-6-5-9-16(17)14-20-18(22)19(11-12-19)13-15-7-3-2-4-8-15/h2-4,7-8,16-17,21H,5-6,9-14H2,1H3,(H,20,22) |
| InChIKey | NCICEASHRAZVBZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |