C16H22N4O3S — CID 96539486
2-indazol-1-yl-N-[[(1R,2S)-2-(methanesulfonamido)cyclopentyl]methyl]acetamide (PubChem CID 96539486) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-indazol-1-yl-N-[[(1R,2S)-2-(methanesulfonamido)cyclopentyl]methyl]acetamide.
| Compound Name | 2-indazol-1-yl-N-[[(1R,2S)-2-(methanesulfonamido)cyclopentyl]methyl]acetamide |
|---|---|
| PubChem CID | 96539486 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-indazol-1-yl-N-[[(1R,2S)-2-(methanesulfonamido)cyclopentyl]methyl]acetamide |
| SMILES | CS(=O)(=O)N[C@H]1CCC[C@@H]1CNC(=O)Cn1ncc2ccccc21 |
| InChI | InChI=1S/C16H22N4O3S/c1-24(22,23)19-14-7-4-6-12(14)9-17-16(21)11-20-15-8-3-2-5-13(15)10-18-20/h2-3,5,8,10,12,14,19H,4,6-7,9,11H2,1H3,(H,17,21)/t12-,14+/m1/s1 |
| InChIKey | GGNWFNCDQSEXGP-OCCSQVGLSA-N |
| XLogP | 0.87 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |