C16H22N4O4S — CID 135117226
N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2-indazol-1-ylacetamide (PubChem CID 135117226) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2-indazol-1-ylacetamide.
| Compound Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2-indazol-1-ylacetamide |
|---|---|
| PubChem CID | 135117226 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[(3S,4S)-4-(dimethylsulfamoylmethyl)oxolan-3-yl]-2-indazol-1-ylacetamide |
| SMILES | CN(C)S(=O)(=O)C[C@@H]1COC[C@H]1NC(=O)Cn1ncc2ccccc21 |
| InChI | InChI=1S/C16H22N4O4S/c1-19(2)25(22,23)11-13-9-24-10-14(13)18-16(21)8-20-15-6-4-3-5-12(15)7-17-20/h3-7,13-14H,8-11H2,1-2H3,(H,18,21)/t13-,14+/m0/s1 |
| InChIKey | URXMPKIAVCFZQZ-UONOGXRCSA-N |
| XLogP | 0.06 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |