C4H8ClN3O — CID 126801829
1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride (PubChem CID 126801829) has the molecular formula C4H8ClN3O and a molecular weight of 149.58 g/mol. Its IUPAC name is 1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride.
| Compound Name | 1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 126801829 |
| Molecular Formula | C4H8ClN3O |
| Molecular Weight | 149.58 g/mol |
| Exact Mass | 149.04 |
| IUPAC Name | 1-(1H-1,2,4-triazol-5-yl)ethanol;hydrochloride |
| SMILES | CC(O)c1ncn[nH]1.Cl |
| InChI | InChI=1S/C4H7N3O.ClH/c1-3(8)4-5-2-6-7-4;/h2-3,8H,1H3,(H,5,6,7);1H |
| InChIKey | SZLCHAKTKBLJGC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.58 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |