About 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride
1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride (PubChem CID 122163926) has the molecular formula C6H12ClN3O
and a molecular weight of 177.63 g/mol. Its IUPAC name is 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride.
Molecular Properties
| Compound Name | 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride |
| PubChem CID | 122163926 |
| Molecular Formula | C6H12ClN3O |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride |
| SMILES | CCc1nc(C(C)O)n[nH]1.Cl |
| InChI | InChI=1S/C6H11N3O.ClH/c1-3-5-7-6(4(2)10)9-8-5;/h4,10H,3H2,1-2H3,(H,7,8,9);1H |
| InChIKey | YLTZLPMOPGOEPA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride?
The IUPAC name of 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride (CID 122163926) is 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride.
What is the SMILES notation for 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride?
The canonical SMILES for 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride is CCc1nc(C(C)O)n[nH]1.Cl.
What is the InChIKey of 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride?
The InChIKey is YLTZLPMOPGOEPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O.ClH/c1-3-5-7-6(4(2)10)9-8-5;/h4,10H,3H2,1-2H3,(H,7,8,9);1H.
What are the key properties of 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride?
1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride has a molecular weight of 177.63 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride is sourced from PubChem (CID 122163926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).