C6H12ClN3O — CID 122163926
1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride (PubChem CID 122163926) has the molecular formula C6H12ClN3O and a molecular weight of 177.63 g/mol. Its IUPAC name is 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride.
| Compound Name | 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 122163926 |
| Molecular Formula | C6H12ClN3O |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 1-(5-ethyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride |
| SMILES | CCc1nc(C(C)O)n[nH]1.Cl |
| InChI | InChI=1S/C6H11N3O.ClH/c1-3-5-7-6(4(2)10)9-8-5;/h4,10H,3H2,1-2H3,(H,7,8,9);1H |
| InChIKey | YLTZLPMOPGOEPA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |